| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| Princeton BioMolecular Research, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (732) 355-9920 | |||
![]() |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | 2-Quinolin-8-Yloxyacetic Acid |
|---|---|
| Synonyms | Zinc00400088 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H8NO3 |
| Molecular Weight | 202.19 |
| CAS Registry Number | 5326-89-6 |
| SMILES | C1=CC=C2C(=C1OCC([O-])=O)N=CC=C2 |
| InChI | 1S/C11H9NO3/c13-10(14)7-15-9-5-1-3-8-4-2-6-12-11(8)9/h1-6H,7H2,(H,13,14)/p-1 |
| InChIKey | PNKYIZBUGAZUHQ-UHFFFAOYSA-M |
| Boiling point | 404.112°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 198.2°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Jun Fan, Zhi-Hong Wang, Ming Yang, Xia Yin, Wei-Guang Zhang, Zhuo-Fen Huang and Rong-Hua Zeng. Controlled synthesis, structures and properties of one-, two-, and three-dimensional lanthanide coordination polymers based on (8-quinolyloxy)acetate, CrystEngComm, 2010, 12, 216. |
|---|---|
| Market Analysis Reports |