| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Szintekon Co, Ltd. | Hungary | |||
|---|---|---|---|---|
![]() |
info@szintekon.hu | |||
| Chemical manufacturer since 1996 | ||||
| Tyger Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (609) 434-0144 | |||
![]() |
sales@tygersci.com | |||
| Chemical manufacturer since 1992 | ||||
| Name | 4-Amino-Chromen-2-One |
|---|---|
| Synonyms | 4-Amino-2-Chromenone; 4-Aminocoumarin; Zinc00337346 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H7NO2 |
| Molecular Weight | 161.16 |
| CAS Registry Number | 53348-92-8 |
| SMILES | C1=CC=CC2=C1C(=CC(O2)=O)N |
| InChI | 1S/C9H7NO2/c10-7-5-9(11)12-8-4-2-1-3-6(7)8/h1-5H,10H2 |
| InChIKey | AHZAKFLOHIRCDU-UHFFFAOYSA-N |
| Density | 1.314g/cm3 (Cal.) |
|---|---|
| Melting point | 232-234°C (Expl.) |
| Boiling point | 338.925°C at 760 mmHg (Cal.) |
| Flash point | 186.57°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Sanjay Paul, Gargi Pal and Asish R. Das. Three-component synthesis of a polysubstituted pyrrole core containing heterocyclic scaffolds over magnetically separable nanocrystalline copper ferrite, RSC Advances, 2013, 3, 8637. |
|---|---|
| Market Analysis Reports |