| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| Simagchem Corporation | China | |||
|---|---|---|---|---|
![]() |
+86 13806087780 | |||
![]() |
sale@simagchem.com | |||
| Chemical manufacturer since 2002 | ||||
| chemBlink premium supplier since 2020 | ||||
| Name | Phosphinothricin |
|---|---|
| Synonyms | 2-Amino-4-(Hydroxy-Methyl-Phosphoryl)Butanoic Acid; 2-Amino-4-(Hydroxy-Methyl-Phosphoryl)Butyric Acid; Ncgc00160382-01 |
| Molecular Structure | ![]() |
| Molecular Formula | C5H12NO4P |
| Molecular Weight | 181.13 |
| CAS Registry Number | 53369-07-6 |
| SMILES | C([P](=O)(O)C)CC(N)C(=O)O |
| InChI | 1S/C5H12NO4P/c1-11(9,10)3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)(H,9,10) |
| InChIKey | IAJOBQBIJHVGMQ-UHFFFAOYSA-N |
| Density | 1.378g/cm3 (Cal.) |
|---|---|
| Boiling point | 519.058°C at 760 mmHg (Cal.) |
| Flash point | 267.717°C (Cal.) |
| (1) | Blodgett et al.. Unusual transformations in the biosynthesis of the antibiotic phosphinothricin tripeptide, Nature Chemical Biology, 2007 |
|---|---|
| Market Analysis Reports |