| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Florida Center for Heterocyclic Compounds | USA | |||
|---|---|---|---|---|
![]() |
+1 (352) 392-0554 | |||
![]() |
katritzky@chem.ufl.edu | |||
| Chemical manufacturer | ||||
| Name | 2,4-Dinitrothiophene |
|---|---|
| Synonyms | Inchi=1/C4h2n2o4s/C7-5(8)3-1-4(6(9)10)11-2-3/H1-2; Nsc3746; Thiophene, 2,4-Dinitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C4H2N2O4S |
| Molecular Weight | 174.13 |
| CAS Registry Number | 5347-12-6 |
| SMILES | C1=C(SC=C1[N+]([O-])=O)[N+]([O-])=O |
| InChI | 1S/C4H2N2O4S/c7-5(8)3-1-4(6(9)10)11-2-3/h1-2H |
| InChIKey | RZKBGZBDWAUWMC-UHFFFAOYSA-N |
| Density | 1.697g/cm3 (Cal.) |
|---|---|
| Boiling point | 312.448°C at 760 mmHg (Cal.) |
| Flash point | 142.764°C (Cal.) |
| (1) | Betty Cottyn, Alexei Starosotnikov, Dominique Vichard, Régis Goumont, Svyatoslav Shevelev and François Terrier. The versatile electrophilic reactivity of 4,6-dinitrobenzo[d]isoxazole-3-carbonitrile, Org. Biomol. Chem., 2009, 7, 1137. |
|---|---|
| Market Analysis Reports |