| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Creative Peptides | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 624-4882 | |||
![]() |
info@creative-peptides.com | |||
| Chemical manufacturer | ||||
| chemBlink massive supplier since 2016 | ||||
| IRIS Biotech GmbH | Germany | |||
|---|---|---|---|---|
![]() |
+49 (9231) 961-973 | |||
![]() |
info@iris-biotech.de | |||
| Chemical manufacturer since 1788 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | |||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Specs Ltd. | Netherlands | |||
|---|---|---|---|---|
![]() |
+31 (15) 251-8111 | |||
![]() |
info@specs.net | |||
| Chemical manufacturer since 1987 | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Histidine derivative |
|---|---|
| Name | N-alpha-Benzoyl-L-Histidine |
| Synonyms | 3-(3H-Imidazol-4-Yl)-2-[(Oxo-Phenylmethyl)Amino]Propanoic Acid; 2-(Benzoylamino)-3-(3H-Imidazol-4-Yl)Propionic Acid; 3-(3H-Imidazol-4-Yl)-2-(Phenylcarbonylamino)Propanoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 |
| CAS Registry Number | 5354-94-9 |
| EINECS | 226-332-8 |
| SMILES | C1=C([NH]C=N1)CC(NC(=O)C2=CC=CC=C2)C(=O)O |
| InChI | 1S/C13H13N3O3/c17-12(9-4-2-1-3-5-9)16-11(13(18)19)6-10-7-14-8-15-10/h1-5,7-8,11H,6H2,(H,14,15)(H,16,17)(H,18,19) |
| InChIKey | AUDPUFBIVWMAED-UHFFFAOYSA-N |
| Density | 1.364g/cm3 (Cal.) |
|---|---|
| Boiling point | 662.28°C at 760 mmHg (Cal.) |
| Flash point | 354.334°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |