|
CAS#: 53549-48-7 Product: 2-Propenamide, Polymer With Ethenylmethylbenzene No suppilers available for the product. |
| Name | 2-Propenamide, Polymer With Ethenylmethylbenzene |
|---|---|
| Synonyms | 1-Methyl-2-Vinyl-Benzene; Prop-2-Enamide; 1-Methyl-2-Vinylbenzene; Prop-2-Enamide; Acrylamide; 1-Methyl-2-Vinyl-Benzene |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 |
| CAS Registry Number | 53549-48-7 |
| SMILES | O=C(N)C=C.C1=C(C(=CC=C1)C)C=C |
| InChI | 1S/C9H10.C3H5NO/c1-3-9-7-5-4-6-8(9)2;1-2-3(4)5/h3-7H,1H2,2H3;2H,1H2,(H2,4,5) |
| InChIKey | YLLOIDQEHCCVPE-UHFFFAOYSA-N |
| Boiling point | 169.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 44.6°C (Cal.) |
| Market Analysis Reports |