| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1,2-Dimethylanthracene |
|---|---|
| Synonyms | anthracene, dimethyl-; InChI=1/C |
| Molecular Structure | ![]() |
| Molecular Formula | C16H14 |
| Molecular Weight | 206.28 |
| CAS Registry Number | 53666-94-7 |
| SMILES | CC1=C(C2=CC3=CC=CC=C3C=C2C=C1)C |
| InChI | 1S/C16H14/c1-11-7-8-15-9-13-5-3-4-6-14(13)10-16(15)12(11)2/h3-10H,1-2H3 |
| InChIKey | PLPFBVXTEJUIIT-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 374.0±12.0°C at 760 mmHg (Cal.) |
| Flash point | 170.9±13.7°C (Cal.) |
| (1) | Xavier Ragàs, Ana Jiménez-Banzo, David Sánchez-García, Xavier Batllori and Santi Nonell. Singlet oxygen photosensitisation by the fluorescent probe Singlet Oxygen Sensor Green®, Chem. Commun., 2009, 2920. |
|---|---|
| Market Analysis Reports |