| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Chem Service, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (610) 692-3026 | |||
![]() |
info@chemservice.com | |||
| Chemical manufacturer since 1962 | ||||
| Chemodex Ltd. | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (71) 244-4825 | |||
![]() |
info@chemodex.com | |||
| Chemical distributor | ||||
| Crescent Chemical Co. Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 348-0333 | |||
![]() |
crescent@creschem.com | |||
| Chemical distributor | ||||
| Classification | Analytical chemistry >> Standard >> Pesticides, veterinary drugs and fertilizers |
|---|---|
| Name | Mefluidide |
| Synonyms | N-[2,4-Dimethyl-5-(Triflylamino)Phenyl]Acetamide; N-[2,4-Dimethyl-5-(Trifluoromethylsulfonylamino)Phenyl]Ethanamide; Mefluidide |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13F3N2O3S |
| Molecular Weight | 310.29 |
| CAS Registry Number | 53780-34-0 |
| EINECS | 258-767-4 |
| SMILES | C1=C(NC(=O)C)C(=CC(=C1N[S](=O)(=O)C(F)(F)F)C)C |
| InChI | 1S/C11H13F3N2O3S/c1-6-4-7(2)10(5-9(6)15-8(3)17)16-20(18,19)11(12,13)14/h4-5,16H,1-3H3,(H,15,17) |
| InChIKey | OKIBNKKYNPBDRS-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 183-185°C (Expl.) |
| SDS | Available |
|---|---|
| (1) | Igor V. Tetko, Vsevolod Yu. Tanchuk, Tamara N. Kasheva, and Alessandro E. P. Villa. Estimation of Aqueous Solubility of Chemical Compounds Using E-State Indices, J. Chem. Inf. Comput. Sci., 2001, 41 (6), pp 1488–1493 |
|---|---|
| Market Analysis Reports |