| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Classification | Organic raw materials >> Carboxylic compounds and derivatives >> Carboxylic acid halide |
|---|---|
| Name | 4-n-Decylbenzoyl Chloride |
| Synonyms | Benzoyl Chloride, 4-Decyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C17H25ClO |
| Molecular Weight | 280.84 |
| CAS Registry Number | 54256-43-8 |
| EINECS | 259-046-7 |
| SMILES | C1=C(C=CC(=C1)C(=O)Cl)CCCCCCCCCC |
| InChI | 1S/C17H25ClO/c1-2-3-4-5-6-7-8-9-10-15-11-13-16(14-12-15)17(18)19/h11-14H,2-10H2,1H3 |
| InChIKey | HEWLDHSFOQXCSI-UHFFFAOYSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 171-173°C (Expl.) |
| 368.2±21.0°C at 760 mmHg (Cal.) | |
| Flash point | 176.4±15.2°C (Cal.) |
| 110°C (Expl.) | |
| Safety Code | S20;S23;S26;S36/37/39;S45 Details |
|---|---|
| Risk Code | R34 Details |
| Hazard Symbol | C Details |
| Transport Information | UN3094 |
| Safety Description | DANGER: CORROSIVE, WATER REACTIVE, burns skin and eyes. |
| SDS | Available |
| Market Analysis Reports |