| Enamine Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 537-3218 | |||
![]() |
enamine@enamine.net | |||
| Chemical manufacturer since 1991 | ||||
| Life Chemicals Inc. | Canada | |||
|---|---|---|---|---|
![]() |
+1 (905) 634-5212 | |||
![]() |
lifechemicals@lifechemicals.com | |||
| Chemical manufacturer since 2004 | ||||
| Otava Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | N-(2-Nitrophenyl)glycine |
|---|---|
| Synonyms | 2-[(2-Nitrophenyl)Amino]Ethanoic Acid; 4-12-00-01582 (Beilstein Handbook Reference); Brn 2808405 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8N2O4 |
| Molecular Weight | 196.16 |
| CAS Registry Number | 5427-99-6 |
| SMILES | C1=CC=CC(=C1[N+]([O-])=O)NCC(=O)O |
| InChI | 1S/C8H8N2O4/c11-8(12)5-9-6-3-1-2-4-7(6)10(13)14/h1-4,9H,5H2,(H,11,12) |
| InChIKey | LGBCEZSPCHBRFQ-UHFFFAOYSA-N |
| Density | 1.488g/cm3 (Cal.) |
|---|---|
| Boiling point | 449.513°C at 760 mmHg (Cal.) |
| Flash point | 225.658°C (Cal.) |
| (1) | Gorostiza Pau. Optical switches and triggers for the manipulation of ion channels and pores, Molecular BioSystems, 2007 |
|---|---|
| Market Analysis Reports |