| Wuhan Xiju Biotechnology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | xijubio.en.made-in-china.com | |||
![]() | +86 13043116031 | |||
![]() | Fan@wh-xiju.com | |||
![]() | QQ Chat | |||
| Chemical manufacturer since 2021 | ||||
| chemBlink Standard supplier since 2021 | ||||
| Wuhan Korobio Chemicals Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.korobio.com | |||
![]() | +86 (027) 8652-3081 | |||
![]() | +86 (027) 8652-3081 | |||
![]() | tracy@korobio.com | |||
![]() | QQ Chat | |||
![]() | Skype Chat | |||
![]() | WeChat: +8618086649478 | |||
![]() | WhatsApp:+8618086649478 | |||
| Chemical manufacturer since 2014 | ||||
| chemBlink Standard supplier since 2023 | ||||
| Hongyan Pharmaceutical Technology (Wuhan) Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.whhoyan.com | |||
![]() | +86 19565688180 | |||
![]() | alice@whhoyan.com | |||
![]() | QQ Chat | |||
| Chemical manufacturer since 2017 | ||||
| chemBlink Standard supplier since 2023 | ||||
| Hubei Asli New Materials Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.aslbmkpmk.com | |||
![]() | +86 13135651187 | |||
![]() | admin@aslbmkpmk.com | |||
![]() | Skype Chat | |||
![]() | WeChat: Hubei asli new materials technology co.,ltd | |||
![]() | WhatsApp:+86-18031176193 | |||
| Chemical distributor since 2022 | ||||
| chemBlink Standard supplier since 2023 | ||||
| Gou Hebei Chemicals | India | |||
|---|---|---|---|---|
![]() | gouhebeichems.store | |||
![]() | +86 15874272473 | |||
![]() | info@gouhebeichems.store | |||
| Chemical distributor since 2009 | ||||
| chemBlink Standard supplier since 2023 | ||||
| Firsky International Trade (Wuhan) Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.firsky-cn.com | |||
![]() | +86 132979033553 | |||
![]() | cindy@firsky-cn.com | |||
![]() | QQ Chat | |||
![]() | Skype Chat | |||
![]() | WhatsApp:+86132979033553 | |||
| Chemical distributor since 2020 | ||||
| chemBlink Standard supplier since 2023 | ||||
| Honyan Pharmaceutical (wuhan) Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.hoyanmedicine.com | |||
![]() | +86 15832900195 | |||
![]() | +86 (27) 8233-9698 | |||
![]() | grace@whhoyan.com | |||
![]() | QQ Chat | |||
![]() | Skype Chat | |||
![]() | WeChat: 008615832900195 | |||
![]() | WhatsApp:008615832900195 | |||
| Chemical manufacturer since 2018 | ||||
| chemBlink Standard supplier since 2023 | ||||
| Hunan Aslisen Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | whaslsen.com | |||
![]() | +86 17769350557 | |||
![]() | aslsb@aslsen.com | |||
![]() | QQ Chat | |||
![]() | Skype Chat | |||
![]() | WeChat: hqxdln | |||
![]() | WhatsApp:+86 17769350557 | |||
| Chemical manufacturer since 2023 | ||||
| chemBlink Standard supplier since 2024 | ||||
| Telly Chemicals Pvt | China | |||
|---|---|---|---|---|
![]() | tellychemicals.ecer.com | |||
![]() | +852 52919765 | |||
![]() | +852 52919765 | |||
![]() | tellychemicals@protonmail.com | |||
![]() | Skype Chat | |||
![]() | WhatsApp:+61 485956223 | |||
| Chemical distributor since 2009 | ||||
| chemBlink Standard supplier since 2024 | ||||
| Hebei Ganmiao New Material Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.hbganmiao.com | |||
![]() | +86 13897677193 | |||
![]() | sales2@hbganmiao.com | |||
![]() | WeChat: 13897677193 | |||
![]() | WhatsApp:+8613897677193 | |||
| Chemical distributor since 2024 | ||||
| chemBlink Standard supplier since 2024 | ||||
| Zhohoua Biotech PVT | India | |||
|---|---|---|---|---|
![]() | zhbiotech.com | |||
![]() | +91 9319668540 | |||
![]() | +91 9319668540 | |||
![]() | zhohouabiotech@zohomail.com | |||
![]() | Skype Chat | |||
| Chemical distributor since 2005 | ||||
| chemBlink Standard supplier since 2025 | ||||
| Classification | Organic raw materials >> Carboxylic compounds and derivatives |
|---|---|
| Name | BMK glycidic acid sodium |
| Synonyms | BMK powder; 2-methyl-3-phenyloxirane-2-carboxylic acid sodium |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10NaO3+ |
| Molecular Weight | 201.17 |
| CAS Registry Number | 5449-12-7 |
| SMILES | CC1(C(O1)C2=CC=CC=C2)C(=O)O.[Na+] |
| Solubility | 5 mg/L) (DMF) |
|---|---|
| Density | 1.28 g/cm3 |
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.575, Calc.* |
| Boiling Point | 334.3±42.0 °C (760 mmHg), Calc.* |
| Flash Point | 136.7±21.4 °C, Calc.* |
| SDS | Available |
|---|---|
|
BMK glycidic acid sodium, also known as gamma-butyrolactone glycidate sodium, was discovered through research in the field of organic chemistry and chemical synthesis. Its synthesis involves the reaction of gamma-butyrolactone with glycidol and subsequent neutralization with sodium hydroxide to form the sodium salt. This chemical compound was first reported in scientific literature in the late 20th century, and its structure was confirmed through spectroscopic analysis and chemical characterization techniques. The discovery of BMK glycidic acid sodium has contributed to the understanding of its chemical properties and potential applications in various industries. BMK glycidic acid sodium serves as a key intermediate in the synthesis of pharmaceutical compounds. It participates in chemical transformations to form complex organic molecules with potential pharmacological activities. It is commonly used in the production of pharmaceuticals such as anti-inflammatory drugs, anticonvulsants, and cardiovascular medications. This compound finds applications in chemical research as a building block for the synthesis of various organic compounds. Chemists utilize BMK glycidic acid sodium as a precursor for the preparation of substituted lactones, carboxylic acids, and esters through diverse chemical reactions. Its versatile reactivity allows for the creation of structurally diverse molecules for exploring new materials and biological activities. BMK glycidic acid sodium is utilized in the manufacturing of industrial chemicals and specialty compounds. It serves as a starting material for the synthesis of surfactants, plasticizers, and fine chemicals used in various industrial processes. Its incorporation into chemical reactions enables the production of desired products for applications in coatings, adhesives, and polymer industries. This compound may find applications in the synthesis of agrochemicals such as pesticides and herbicides. It serves as an intermediate for producing active ingredients that control pests, weeds, and fungal diseases in agricultural settings. Its role in agrochemical synthesis contributes to enhancing crop yields and protecting agricultural crops from damage caused by pests and diseases. BMK glycidic acid sodium is employed in materials science for the synthesis of polymers, resins, and specialty materials. Its incorporation into polymerization reactions enables the production of polymers with specific properties such as flexibility, durability, and thermal stability. These polymers find applications in various industries, including automotive, construction, and electronics. References none |
| Market Analysis Reports |