|
CAS#: 54644-40-5 Product: Pivalic Acid Mesityl Ester No suppilers available for the product. |
| Name | Pivalic Acid Mesityl Ester |
|---|---|
| Synonyms | 2,2-Dimethylpropanoic Acid (2,4,6-Trimethylphenyl) Ester; 2,2-Dimethylpropionic Acid (2,4,6-Trimethylphenyl) Ester; 2,2-Dimethylpropanoic Acid, 2,4,6-Trimethylphen* |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 |
| CAS Registry Number | 54644-40-5 |
| SMILES | C1=C(C)C(=C(C=C1C)C)OC(=O)C(C)(C)C |
| InChI | 1S/C14H20O2/c1-9-7-10(2)12(11(3)8-9)16-13(15)14(4,5)6/h7-8H,1-6H3 |
| InChIKey | LQPZFAMVTOHECS-UHFFFAOYSA-N |
| Density | 0.977g/cm3 (Cal.) |
|---|---|
| Boiling point | 284.044°C at 760 mmHg (Cal.) |
| Flash point | 103.988°C (Cal.) |
| (1) | Tadashi Mori, Makoto Takamoto, Takehiko Wada and Yoshihisa Inoue. Acid-controlled photoreactions of aryl alkanoates: competition of transesterification, decarboxylation, Fries-rearrangement and/or transposition, Photochem. Photobiol. Sci., 2003, 2, 1187. |
|---|---|
| Market Analysis Reports |