| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Manchester Organics Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | |||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | Ethyl (E)-3-(1-Pyrrolidino)Crotonate |
|---|---|
| Synonyms | Ethyl (E)-3-Pyrrolidin-1-Ylbut-2-Enoate; 3-1-Pyrrolidinylbut-2-Enoic Acid Ethyl Ester; (E)-3-1-Pyrrolidinylbut-2-Enoic Acid Ethyl Ester |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 |
| CAS Registry Number | 54716-02-8 |
| EINECS | 259-303-3 |
| SMILES | C(OC(\C=C(N1CCCC1)/C)=O)C |
| InChI | 1S/C10H17NO2/c1-3-13-10(12)8-9(2)11-6-4-5-7-11/h8H,3-7H2,1-2H3/b9-8+ |
| InChIKey | MSOQKPXSIHLODG-CMDGGOBGSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 263.1±19.0°C at 760 mmHg (Cal.) |
| 125-126°C (Expl.) | |
| Flash point | 99.2±12.4°C (Cal.) |
| Refractive index | 1.541 (Expl.) |
| Safety Code | S26;S37 Details |
|---|---|
| Risk Code | R36/38 Details |
| Hazard Symbol | X Details |
| Safety Description | IRRITANT |
| WARNING: Irritates skin and eyes | |
| SDS | Available |
| Market Analysis Reports |