| Atomole Scientific Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (27) 8262-4262 | |||
![]() |
sales@atomole.com | |||
| Chemical manufacturer since 2008 | ||||
| Chemodex Ltd. | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (71) 244-4825 | |||
![]() |
info@chemodex.com | |||
| Chemical distributor | ||||
| Extrasynthese Chemical S.A.S. | France | |||
|---|---|---|---|---|
![]() |
+33 (47) 898-2034 | |||
![]() |
info@extrasynthese.com | |||
| Chemical manufacturer | ||||
| Glentham Life Sciences | UK | |||
|---|---|---|---|---|
![]() |
+44 (2033) 978-798 | |||
![]() |
info@glenthamls.com | |||
| Chemical distributor since 2013 | ||||
| Merck Millipore | USA | |||
|---|---|---|---|---|
![]() |
+86 (10) 5989-8600 | |||
![]() |
asiatechserv@millipore.com | |||
| Chemical manufacturer since 1954 | ||||
| SynQuest Labs, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | (8alpha,9R)-6'-Methoxycinchonan-9-Ol |
|---|---|
| Synonyms | (-)-Quinine; (8S,9R)-QUININE; (9R)-6'-methoxy-8α-cinchonan-9-ol |
| Molecular Structure | ![]() |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 |
| CAS Registry Number | 549-50-8 |
| EINECS | 208-968-8 |
| SMILES | COC1=CC2=C(C=CN=C2C=C1)[C@H]([C@@H]3C[C@@H]4CC[N@]3C[C@@H]4C=C)O |
| InChI | 1S/C20H24N2O2/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3/t13-,14-,19-,20+/m0/s1 |
| InChIKey | LOUPRKONTZGTKE-WZBLMQSHSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 174-178°C (Expl.) |
| Boiling point | 495.9±40.0°C at 760 mmHg (Cal.) |
| Flash point | 253.7±27.3°C (Cal.) |
| solubility | MeOH |
| Safety Description | Harmful/Irritant/Light Sensitive/Hygroscopic/Store under Argon |
|---|---|
| (1) | Kato et al.. Gene expression signatures and small molecule compounds link a protein kinase to Plasmodium falciparum motility, Nature Chemical Biology, 2008 |
|---|---|
| Market Analysis Reports |