| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 2-(2-Propoxyphenyl)-8-Aza-6-Purinone |
|---|---|
| Synonyms | 5-(2-Propoxyphenyl)-2,3-Dihydro-[1,2,3]Triazolo[4,5-E]Pyrimidin-7-One; M And B 22948; M&B 22,948 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H13N5O2 |
| Molecular Weight | 271.28 |
| CAS Registry Number | 55122-20-8 |
| SMILES | C1=C(C(=CC=C1)OCCC)C3=NC(=O)C2=NNNC2=N3 |
| InChI | 1S/C13H13N5O2/c1-2-7-20-9-6-4-3-5-8(9)11-14-12-10(13(19)15-11)16-18-17-12/h3-6H,2,7H2,1H3,(H2,14,15,16,17,18,19) |
| InChIKey | REZGGXNDEMKIQB-UHFFFAOYSA-N |
| Density | 1.484g/cm3 (Cal.) |
|---|---|
| Boiling point | 406.26°C at 760 mmHg (Cal.) |
| Flash point | 199.499°C (Cal.) |
| solubility | Soluble to 100 mM in DMSO |
| Market Analysis Reports |