| Carbosynth China Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (512) 6260-5585 | |||
![]() |
sales@carbosynth.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink massive supplier since 2016 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Interchim Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (800) 560-8262 | |||
![]() |
web@interchiminc.com | |||
| Chemical manufacturer | ||||
| Classification | Organic raw materials >> Carboxylic compounds and derivatives >> Salt of carboxylic acid ester and its derivatives |
|---|---|
| Name | Sodium Anthranilate |
| Synonyms | Sodium Anthranilate; Sodium Aminobenzoate |
| Molecular Structure | ![]() |
| Molecular Formula | C7H6NNaO2 |
| Molecular Weight | 159.12 |
| CAS Registry Number | 552-37-4 |
| EINECS | 275-890-9 |
| SMILES | C1=CC=CC(=C1C(=O)[O-])N.[Na+] |
| InChI | 1S/C7H7NO2.Na/c8-6-4-2-1-3-5(6)7(9)10;/h1-4H,8H2,(H,9,10);/q;+1/p-1 |
| InChIKey | HCKKSLZDSNNSTL-UHFFFAOYSA-M |
| Boiling point | 311.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 142.4°C (Cal.) |
| Market Analysis Reports |