| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Mappicine Ketone |
|---|---|
| Synonyms | 8-Methyl-7-(1-Oxopropyl)-11H-Indolizino[1,2-B]Quinolin-9-One; 8-Methyl-7-Propionyl-11H-Indolizino[1,2-B]Quinolin-9-One; Nothapodytine B |
| Molecular Structure | ![]() |
| Molecular Formula | C19H16N2O2 |
| Molecular Weight | 304.35 |
| CAS Registry Number | 55854-89-2 |
| SMILES | C3=C2CN1C(=CC(=C(C1=O)C)C(=O)CC)C2=NC4=C3C=CC=C4 |
| InChI | 1S/C19H16N2O2/c1-3-17(22)14-9-16-18-13(10-21(16)19(23)11(14)2)8-12-6-4-5-7-15(12)20-18/h4-9H,3,10H2,1-2H3 |
| InChIKey | QHTFEANXLNNBOX-UHFFFAOYSA-N |
| Density | 1.329g/cm3 (Cal.) |
|---|---|
| Boiling point | 591.662°C at 760 mmHg (Cal.) |
| Flash point | 311.626°C (Cal.) |
| (1) | Turner Charles Dylan, Ciufolini Marco A. Directed aromatic functionalization in natural-product synthesis: Fredericamycin A, nothapodytine B, and topopyrones B and D, Beilstein Journal of Organic Chemistry, 2011 |
|---|---|
| Market Analysis Reports |