| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Classification | Pharmaceutical intermediate >> Heterocyclic compound intermediate >> Pyridazine |
|---|---|
| Name | Mesoridazine |
| Synonyms | 10-[2-(1-Methyl-2-Piperidyl)Ethyl]-2-Methylsulfinyl-Phenothiazine; 10-[2-(1-Methyl-2-Piperidinyl)Ethyl]-2-Methylsulfinylphenothiazine; 10-[2-(1-Methylpiperidin-2-Yl)Ethyl]-2-Methylsulfinyl-Phenothiazine |
| Molecular Structure | ![]() |
| Molecular Formula | C21H26N2OS2 |
| Molecular Weight | 386.57 |
| CAS Registry Number | 5588-33-0 |
| SMILES | C1=C([S](C)=O)C=CC3=C1N(C2=C(C=CC=C2)S3)CCC4N(CCCC4)C |
| InChI | 1S/C21H26N2OS2/c1-22-13-6-5-7-16(22)12-14-23-18-8-3-4-9-20(18)25-21-11-10-17(26(2)24)15-19(21)23/h3-4,8-11,15-16H,5-7,12-14H2,1-2H3 |
| InChIKey | SLVMESMUVMCQIY-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 570.5±50.0°C at 760 mmHg (Cal.) |
| Flash point | 298.9±30.1°C (Cal.) |
| (1) | Hongmao Sun. An Accurate and Interpretable Bayesian Classification Model for Prediction of hERG Liability, ChemMedChem 2006, 1(3), 315-322. |
|---|---|
| Market Analysis Reports |