|
CAS#: 559-48-8 Product: Methyl 3-hydroxy-22-oxokopsan-1-carboxylate No suppilers available for the product. |
| Name | Methyl 3-hydroxy-22-oxokopsan-1-carboxylate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 |
| CAS Registry Number | 559-48-8 |
| SMILES | COC(=O)N1C2=CC=CC=C2[C@@]34[C@]15CC[C@]67[C@@H]3N(CCC6)C[C@@H]4C(=O)[C@@]5(C7)O |
| InChI | 1S/C22H24N2O4/c1-28-18(26)24-15-6-3-2-5-13(15)22-14-11-23-10-4-7-19(17(22)23)8-9-21(22,24)20(27,12-19)16(14)25/h2-3,5-6,14,17,27H,4,7-12H2,1H3/t14-,17+,19-,20-,21-,22+/m1/s1 |
| InChIKey | YROYAGSZNDUMIF-MQVQQYNVSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 579.0±50.0°C at 760 mmHg (Cal.) |
| Flash point | 304.0±30.1°C (Cal.) |
| (1) | Toh-Seok Kam, Tuck-Meng Lim and Guan-Huat Tan. Electrochemical oxidation of aspidofractinine-type alkaloids: Formation of kopsine, kopsidine, kopsinitarine and bisindole derivatives, J. Chem. Soc., Perkin Trans. 1, 2001, 0, 1594. |
|---|---|
| Market Analysis Reports |