| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Metcaraphen |
|---|---|
| Synonyms | 1-(3,4-Dimethylphenyl)-1-Cyclopentanecarboxylic Acid 2-Diethylaminoethyl Ester; 1-(3,4-Dimethylphenyl)Cyclopentane-1-Carboxylic Acid 2-Diethylaminoethyl Ester; Metcaraphen |
| Molecular Structure | ![]() |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 |
| CAS Registry Number | 561-79-5 |
| SMILES | C1=C(C(=CC=C1C2(C(OCCN(CC)CC)=O)CCCC2)C)C |
| InChI | 1S/C20H31NO2/c1-5-21(6-2)13-14-23-19(22)20(11-7-8-12-20)18-10-9-16(3)17(4)15-18/h9-10,15H,5-8,11-14H2,1-4H3 |
| InChIKey | PZXHGLCYRMTHNF-UHFFFAOYSA-N |
| Density | 1.02g/cm3 (Cal.) |
|---|---|
| Boiling point | 424.237°C at 760 mmHg (Cal.) |
| Flash point | 127.956°C (Cal.) |
| (1) | Nirveek BhattacharjeeThese two authors contributed equally to the work., Nianzhen Li, Thomas M. Keenan and Albert Folch. A neuron-benign microfluidic gradient generator for studying the response of mammalian neurons towards axon guidance factors, Integr. Biol., 2010, 2, 669. |
|---|---|
| Market Analysis Reports |