| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Ximoprofen |
|---|---|
| Synonyms | 2-[4-[(3Z)-3-Hydroximinocyclohexyl]Phenyl]Propionic Acid; 2-(4-(3-Hydroxyiminocyclohexyl)Phenylpropionsaeure; 4-(3-Hydroxyiminocyclohexyl)Hydratropasaeure |
| Molecular Structure | ![]() |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 |
| CAS Registry Number | 56187-89-4 |
| EINECS | 260-041-7 |
| SMILES | C1=CC(=CC=C1C2C\C(CCC2)=N/O)C(C(O)=O)C |
| InChI | 1S/C15H19NO3/c1-10(15(17)18)11-5-7-12(8-6-11)13-3-2-4-14(9-13)16-19/h5-8,10,13,19H,2-4,9H2,1H3,(H,17,18)/b16-14- |
| InChIKey | IQPPOXSMSDPZKU-PEZBUJJGSA-N |
| Density | 1.228g/cm3 (Cal.) |
|---|---|
| Boiling point | 465.357°C at 760 mmHg (Cal.) |
| Flash point | 235.24°C (Cal.) |
| (1) | Zhao YH, Abraham MH, Le J, Hersey A, Luscombe CN, Beck G, Sherborne B, and Cooper I. Rate-limited Steps of Human Oral Absorption and QSAR Studies, Pharm Res., 2002, 19(10), 1446-57 |
|---|---|
| Market Analysis Reports |