|
CAS#: 5624-60-2 Product: Benzene-1,3,5-Triyltris(Trimethylsilane) No suppilers available for the product. |
| Name | Benzene-1,3,5-Triyltris(Trimethylsilane) |
|---|---|
| Synonyms | [3,5-Bis(trimethylsilyl)phenyl](trimethyl)silane #; 1,3,5-Benzenetriyltris(trimethylsilane); 1,3,5-Tris(trimethylsilyl)benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C15H30Si3 |
| Molecular Weight | 294.66 |
| CAS Registry Number | 5624-60-2 |
| SMILES | c1c(cc(cc1[Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C |
| InChI | 1S/C15H30Si3/c1-16(2,3)13-10-14(17(4,5)6)12-15(11-13)18(7,8)9/h10-12H,1-9H3 |
| InChIKey | ALVFOQHWIKQDKY-UHFFFAOYSA-N |
| Density | 0.857g/cm3 (Cal.) |
|---|---|
| Boiling point | 244.636°C at 760 mmHg (Cal.) |
| Flash point | 65.023°C (Cal.) |
| (1) | Farha et al.. De novo synthesis of a metal-organic framework material featuring ultrahigh surface area and gas storage capacities, Nature Chemistry, 2010 |
|---|---|
| Market Analysis Reports |