| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| ChemDiv, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 794-4860 | |||
![]() |
chemdiv@chemdiv.com | |||
| Chemical manufacturer | ||||
| Name | 1,4-Bis(2-Carboxyethyl)Piperazine |
|---|---|
| Synonyms | 3-[4-(2-Carboxyethyl)-1-Piperazinyl]Propanoic Acid; 3-[4-(2-Carboxyethyl)Piperazin-1-Yl]Propionic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26 |
| CAS Registry Number | 5649-49-0 |
| EINECS | 227-088-5 |
| SMILES | C(N1CCN(CCC(O)=O)CC1)CC(O)=O |
| InChI | 1S/C10H18N2O4/c13-9(14)1-3-11-5-7-12(8-6-11)4-2-10(15)16/h1-8H2,(H,13,14)(H,15,16) |
| InChIKey | WCJNJOOLQWJKLU-UHFFFAOYSA-N |
| Density | 1.238g/cm3 (Cal.) |
|---|---|
| Boiling point | 458.054°C at 760 mmHg (Cal.) |
| Flash point | 230.823°C (Cal.) |
| (1) | Guoliang Li, Jian Lü, Xinfa Li, Hongxun Yang, Bo Xu and Rong Cao. Coordination polymers of 1,4-piperazinedipropionic acid: domination by flexibility, coordination, and/or configuration?, CrystEngComm, 2010, 12, 3780. |
|---|---|
| Market Analysis Reports |