| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Alfa Pyridines | USA | |||
|---|---|---|---|---|
![]() |
+1 (609) 447-3255 | |||
![]() |
sales@pyridines.info | |||
| Chemical manufacturer | ||||
| Name | Zimelidine Dihydrochloride |
|---|---|
| Synonyms | (Z)-3-(4-Bromophenyl)-N,N-Dimethyl-3-Pyridin-3-Ylprop-2-En-1-Amine; (Z)-3-(4-Bromophenyl)-N,N-Dimethyl-3-(3-Pyridyl)Prop-2-En-1-Amine; 3-(4-Bromophenyl)-N,N-Dimethyl-3-(3-Pyridyl)Prop-2-En-1-Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C16H17BrN2 |
| Molecular Weight | 317.23 |
| CAS Registry Number | 56775-88-3 |
| SMILES | C2=C(\C(C1=CC=CN=C1)=C\CN(C)C)C=CC(=C2)Br |
| InChI | 1S/C16H17BrN2/c1-19(2)11-9-16(14-4-3-10-18-12-14)13-5-7-15(17)8-6-13/h3-10,12H,11H2,1-2H3/b16-9- |
| InChIKey | OYPPVKRFBIWMSX-SXGWCWSVSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 412.8±45.0°C at 760 mmHg (Cal.) |
| Flash point | 203.4±28.7°C (Cal.) |
| (1) | Manthena V. S. Varma, Khandavilli Sateesh, and Ramesh Panchagnula. Functional Role of P-Glycoprotein in Limiting Intestinal Absorption of Drugs: Contribution of Passive Permeability to P-Glycoprotein Mediated Efflux Transport, Mol. Pharmaceutics 2005, 2(1), 12-21. |
|---|---|
| Market Analysis Reports |