| Ereztech LLC | USA | |||
|---|---|---|---|---|
![]() | www.ereztech.com | |||
![]() | +1 (888) 658-1221 | |||
![]() | sales@ereztech.com | |||
| Chemical distributor since 2010 | ||||
| chemBlink Standard supplier since 2011 | ||||
| Intatrade Chemicals GmbH | Germany | |||
|---|---|---|---|---|
![]() | www.intatrade.de | |||
![]() | +49 (3493) 605-465 | |||
![]() | +49 (3493) 605-470 | |||
![]() | sales@intatrade.de | |||
| Chemical distributor | ||||
| chemBlink Standard supplier since 2011 | ||||
| Fujian Wolfa Biotechnology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.wolfabio.com | |||
![]() | +86 18050950397 | |||
![]() | jomin@wolfabio.com | |||
![]() | WhatsApp:+86 18359103607 | |||
| Chemical manufacturer since 2023 | ||||
| chemBlink Standard supplier since 2024 | ||||
| Classification | Organic raw materials >> Organometallic compound >> Organic germanium, cobalt, strontium, barium, gallium, germanium, germanium, germanium, germanium, etc. |
|---|---|
| Name | tert-Butylacetylenedicobalthexacarbonyl |
| Synonyms | (3,3-DIMETHYL-1-BUTYNE)DICOBALT HEXACARBONYL |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10Co2O6 |
| Molecular Weight | 368.07 |
| CAS Registry Number | 56792-69-9 |
| EC Number | 633-704-7 |
| SMILES | CC(C)(C)C#C[Co](C#O)(C#O)(C#O)[Co](C#O)(C#O)C#O |
| Hazard Symbols | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H225-H315-H319-H335 Details | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Safety Statements | P231-P301+P310-P305+P351+P338-P403+P233-P422-P501 Details | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
tert-Butylacetylenedicobalthexacarbonyl, with the chemical formula C₁₂H₁₈Co₂O₆, is a notable organometallic compound featuring cobalt in a unique chemical environment. This compound is characterized by the coordination of two cobalt centers with six carbonyl groups and a tert-butylacetylenic ligand, leading to distinctive chemical and physical properties. The discovery of tert-butylacetylenedicobalthexacarbonyl emerged from research into cobalt carbonyl complexes and their applications in catalysis. The synthesis of this compound typically involves the reaction of cobalt carbonyls with tert-butylacetylene, resulting in the formation of a complex where the cobalt centers are bridged by the acetylenic ligand. This structure not only stabilizes the cobalt atoms but also imparts unique reactivity and coordination properties. In industrial and research applications, tert-butylacetylenedicobalthexacarbonyl is primarily used as a catalyst or catalyst precursor. Its ability to facilitate a range of chemical reactions, including polymerization and cross-coupling processes, makes it a valuable tool in synthetic chemistry. The cobalt-carbonyl framework provides a stable environment for catalyzing reactions that involve the formation and cleavage of carbon-carbon bonds. This capability is particularly useful in the synthesis of complex organic molecules and in materials science. Another significant application of this compound is in the study of organometallic chemistry and coordination complexes. Researchers use tert-butylacetylenedicobalthexacarbonyl to explore the behavior of cobalt in various chemical environments and to develop new materials with tailored properties. The compound’s unique structure contributes to understanding the role of metal centers in catalytic processes and the design of innovative organometallic systems. Handling tert-butylacetylenedicobalthexacarbonyl requires adherence to standard safety practices due to the potential hazards associated with cobalt carbonyls and organometallic compounds. Proper safety measures, including working in well-ventilated areas and using appropriate personal protective equipment, are essential to ensure safe use and storage of the compound. Ongoing research continues to investigate new applications and refine the use of tert-butylacetylenedicobalthexacarbonyl. Advances in catalysis, materials science, and coordination chemistry are expected to enhance the compound’s utility and lead to innovative applications in these fields. In summary, tert-butylacetylenedicobalthexacarbonyl is an important organometallic compound with significant applications in catalysis and coordination chemistry. Its discovery and development have contributed to advancements in these areas, and continued research promises to uncover additional uses and improvements. References none |
| Market Analysis Reports |