| R&D Scientific Inc. | Canada | |||
|---|---|---|---|---|
![]() | www.rdscientific.com | |||
![]() | +1 (226) 600-0236 | |||
![]() | sales@rdscientific.com | |||
| Chemical manufacturer since 2016 | ||||
| chemBlink Standard supplier since 2023 | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Ester amino acid |
|---|---|
| Name | Methyl 2-amino-6-nitrobenzoate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8N2O4 |
| Molecular Weight | 196.16 |
| CAS Registry Number | 57113-89-0 |
| EC Number | 823-540-6 |
| SMILES | COC(=O)C1=C(C=CC=C1[N+](=O)[O-])N |
| Solubility | 244.8 mg/L (25 °C water) |
|---|---|
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.606, Calc.* |
| Melting point | 117.73 °C |
| Boiling Point | 333.68 °C, 339.2±22.0 °C (760 mmHg), Calc.* |
| Flash Point | 158.9±22.3 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H302-H315-H319-H335 Details | ||||||||||||||||||||||||||||
| Safety Statements | P261-P305+P351+P338 Details | ||||||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||||||||||
| Market Analysis Reports |