|
CAS#: 573-41-1 Product: Theophylline-2-Aminoethanol No suppilers available for the product. |
| Name | Theophylline-2-Aminoethanol |
|---|---|
| Synonyms | 2-Aminoethanol; 1,3-Dimethyl-7H-Purine-2,6-Quinone; 1H-Purine-2,6-Dione, 3,7-Dihydro-1,3-Dimethyl-, Compd. With 2-Aminoethanol (1:1); Clysmathane |
| Molecular Structure | ![]() |
| Molecular Formula | C9H15N5O3 |
| Molecular Weight | 241.25 |
| CAS Registry Number | 573-41-1 |
| EINECS | 209-355-8 |
| SMILES | C1=NC2=C([NH]1)C(=O)N(C(=O)N2C)C.C(O)CN |
| InChI | 1S/C7H8N4O2.C2H7NO/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;3-1-2-4/h3H,1-2H3,(H,8,9);4H,1-3H2 |
| InChIKey | DAAFJZUNCOXSKD-UHFFFAOYSA-N |
| Boiling point | 454.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 228.4°C (Cal.) |
| Market Analysis Reports |