| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 4-(Dimethylamino)-1,2-Diphenyl-3,5-Pyrazolidinedione |
|---|---|
| Synonyms | 4-(Dimethylamino)-1,2-diphenyl-3,5-pyrazolidinedione # |
| Molecular Structure | ![]() |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 |
| CAS Registry Number | 57488-07-0 |
| SMILES | O=C2N(c1ccccc1)N(C(=O)C2N(C)C)c3ccccc3 |
| InChI | 1S/C17H17N3O2/c1-18(2)15-16(21)19(13-9-5-3-6-10-13)20(17(15)22)14-11-7-4-8-12-14/h3-12,15H,1-2H3 |
| InChIKey | VSONVDVHHITTRV-UHFFFAOYSA-N |
| Density | 1.299g/cm3 (Cal.) |
|---|---|
| Boiling point | 418.167°C at 760 mmHg (Cal.) |
| Flash point | 177.192°C (Cal.) |
| (1) | Selva A, Citterio A, Merlini L. Mass Spectrometry of Heterocyclic compounds. VIII. Electron-impact-induced fragmentation of 1,2-diphenyl-pyrazolidine-3,5-dione and some 4-substituted derivatives, Organic Mass Spectrometry 1975, 10, 606-616 |
|---|---|
| Market Analysis Reports |