|
CAS#: 57609-68-4 Product: 4,9,10,11-Tetrahydro-2-methoxy-3-methyl-7-phenyl-1H-Cyclohepta[f]quinolin-1-one No suppilers available for the product. |
| Name | 4,9,10,11-Tetrahydro-2-methoxy-3-methyl-7-phenyl-1H-Cyclohepta[f]quinolin-1-one |
|---|---|
| Synonyms | 2-Methoxy-3-Methyl-7-Phenyl-9,10,11-Trihydro(4H)-Cyclohepta(F)Quinolinone; C10727; Melochinone |
| Molecular Structure | ![]() |
| Molecular Formula | C22H21NO2 |
| Molecular Weight | 331.41 |
| CAS Registry Number | 57609-68-4 |
| SMILES | C2=CC1=C(C(C(=C(N1)C)OC)=O)C3=C2C(=CCCC3)C4=CC=CC=C4 |
| InChI | 1S/C22H21NO2/c1-14-22(25-2)21(24)20-18-11-7-6-10-16(15-8-4-3-5-9-15)17(18)12-13-19(20)23-14/h3-5,8-10,12-13H,6-7,11H2,1-2H3,(H,23,24) |
| InChIKey | DNBWHNVLJOVDJI-UHFFFAOYSA-N |
| Density | 1.221g/cm3 (Cal.) |
|---|---|
| Boiling point | 514.761°C at 760 mmHg (Cal.) |
| Flash point | 265.118°C (Cal.) |
| (1) | Michael Joseph P.. Quinoline, quinazoline and acridone alkaloids, Natural Product Reports, 2007 |
|---|---|
| Market Analysis Reports |