| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Otava Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 3-Phenoxybenzoylglycine |
|---|---|
| Synonyms | 2-[[Oxo-[3-(Phenoxy)Phenyl]Methyl]Amino]Acetic Acid; 2-[[3-(Phenoxy)Phenyl]Carbonylamino]Ethanoic Acid; N-3-(Phenoxybenzoyl)Glycine |
| Molecular Structure | ![]() |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.27 |
| CAS Registry Number | 57991-36-3 |
| SMILES | C1=C(C=CC=C1C(NCC(=O)O)=O)OC2=CC=CC=C2 |
| InChI | 1S/C15H13NO4/c17-14(18)10-16-15(19)11-5-4-8-13(9-11)20-12-6-2-1-3-7-12/h1-9H,10H2,(H,16,19)(H,17,18) |
| InChIKey | IHTUCGBIFBJPEK-UHFFFAOYSA-N |
| Density | 1.283g/cm3 (Cal.) |
|---|---|
| Boiling point | 504.314°C at 760 mmHg (Cal.) |
| Flash point | 258.8°C (Cal.) |
| (1) | Anna R. McCarthy, Barbara M. Thomson, Ian C. Shaw and Andrew D. Abell. Estrogenicity of pyrethroid insecticide metabolites, J. Environ. Monit., 2006, 8, 197. |
|---|---|
| Market Analysis Reports |