| Leap Chem Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (852) 3060-6658 | |||
![]() |
market19@leapchem.com | |||
![]() |
QQ Chat | |||
| Chemical distributor since 2006 | ||||
| chemBlink massive supplier since 2022 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Indofine Chemical Company, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (908) 359-6778 | |||
![]() |
fo@indofinechemical.com | |||
| Chemical manufacturer since 1996 | ||||
| Name | Dihydronicotinamide-Adenine Dinucleotide |
|---|---|
| Synonyms | Adenosine 5'-(Trihydrogen Diphosphate), P'-5'-Ester With 1,4-Dihydro-1-Beta-D-Ribofuranosyl-3-Pyridinecarboxamide; Adenosine 5'-(Trihydrogen Pyrophosphate), 5'-5'-Ester With 1,4-Dihydro-1Beta-D-Ribofuranosylnicotinamide; Codehydrase I, Reduced |
| Molecular Structure | ![]() |
| Molecular Formula | C21H29N7O14P2 |
| Molecular Weight | 665.45 |
| CAS Registry Number | 58-68-4 |
| EINECS | 200-393-0 |
| SMILES | [C@H]1(O)[C@@H](O)[C@@H](O[C@@H]1CO[P](O[P](OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)C4=NC3=NC=NC(=C3[NH]4)N)(O)=O)(O)=O)N5C=C(CC=C5)C(=O)N |
| InChI | 1S/C21H29N7O14P2/c22-17-11-19(25-7-24-17)27-20(26-11)16-14(31)12(29)9(40-16)5-38-43(34,35)42-44(36,37)39-6-10-13(30)15(32)21(41-10)28-3-1-2-8(4-28)18(23)33/h1,3-4,7,9-10,12-16,21,29-32H,2,5-6H2,(H2,23,33)(H,34,35)(H,36,37)(H3,22,24,25,26,27)/t9-,10-,12-,13-,14-,15-,16-,21-/m1/s1 |
| InChIKey | ITHLNINGIUMTDS-VJOGCJHKSA-N |
| Density | 1.868g/cm3 (Cal.) |
|---|---|
| Boiling point | 1136.101°C at 760 mmHg (Cal.) |
| Flash point | 640.891°C (Cal.) |
| (1) | Hucheng Chang, Xiaojing Wu, Changyu Wu, Yu Chen, Hui Jiang and Xuemei Wang. Catalytic oxidation and determination of β-NADH using self-assembly hybrid of gold nanoparticles and graphene, Analyst, 2011, 136, 2735. |
|---|---|
| Market Analysis Reports |