| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Frinton Laboratories, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (856) 722-7037 | |||
![]() |
frinton@frinton.com | |||
| Chemical manufacturer | ||||
| Interchim Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (800) 560-8262 | |||
![]() |
web@interchiminc.com | |||
| Chemical manufacturer | ||||
| Specs Ltd. | Netherlands | |||
|---|---|---|---|---|
![]() |
+31 (15) 251-8111 | |||
![]() |
info@specs.net | |||
| Chemical manufacturer since 1987 | ||||
| Classification | Organic raw materials >> Carboxylic compounds and derivatives >> Carboxylic esters and their derivatives |
|---|---|
| Name | Acetylsalicylic Acid Methyl Ester |
| Synonyms | Methyl 2-Acetoxybenzoate; 2-Acetoxybenzoic Acid Methyl Ester; Methyl Aspirin |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 |
| CAS Registry Number | 580-02-9 |
| EINECS | 209-450-4 |
| SMILES | C1=CC=CC(=C1OC(C)=O)C(OC)=O |
| InChI | 1S/C10H10O4/c1-7(11)14-9-6-4-3-5-8(9)10(12)13-2/h3-6H,1-2H3 |
| InChIKey | ONWPLBKWMAUFGZ-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 50°C (Expl.) |
| Boiling point | 254.9±13.0°C at 760 mmHg (Cal.) |
| Flash point | 121.4±18.2°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |