| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Tris(4-Morpholino)Phosphine |
|---|---|
| Synonyms | Trimorpholinophosphane; Nsc92800; Tris(Morpholino)Phosphine |
| Molecular Structure | ![]() |
| Molecular Formula | C12H24N3O3P |
| Molecular Weight | 289.31 |
| CAS Registry Number | 5815-61-2 |
| SMILES | C3N(P(N1CCOCC1)N2CCOCC2)CCOC3 |
| InChI | 1S/C12H24N3O3P/c1-7-16-8-2-13(1)19(14-3-9-17-10-4-14)15-5-11-18-12-6-15/h1-12H2 |
| InChIKey | CYABZYIVQJYRDT-UHFFFAOYSA-N |
| Boiling point | 401.832°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 196.821°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Shang Gao, Hongling Guo, Xiaojun Peng, Xing Zhao, Qian Duan, Qingcheng Liang and Dayong Jiang. The employment of a hydrophilic tris(morpholino)phosphine ligand in diiron propane-1,3-dithiolate complexes for potentially water-soluble iron-only hydrogenase active-site mimics, New J. Chem., 2013, 37, 1437. |
|---|---|
| Market Analysis Reports |