Online Database of Chemicals from Around the World

5,6-Dimethoxybenzo[d]thiazole
[CAS 58249-69-7]

List of Suppliers
Fenhe Chemical Co., Ltd. China
www.fenhechem.com
+86 (021) 3392-6068
julius.wei@fenhechem.com
Chemical manufacturer since 1997
chemBlink Standard supplier since 2024

Identification
ClassificationFlavors and spices >> Synthetic spice >> Lactone and oxygen-containing heterocyclic compound >> Thiazole, thiophene and pyridine
Name5,6-Dimethoxybenzo[d]thiazole
Molecular Structure5,6-Dimethoxybenzo[d]thiazole molecular structure (CAS 58249-69-7)
Molecular FormulaC9H9NO2S
Molecular Weight195.24
CAS Registry Number58249-69-7
SMILESCOC1=C(C=C2C(=C1)N=CS2)OC
Safety Data
Hazard Symbolssymbol   GHS07 Warning  Details
Risk StatementsH302-H315-H319-H335  Details
Safety StatementsP261-P305+P351+P338  Details
SDSAvailable
up Discovery and Applications
5,6-Dimethoxybenzo[d]thiazole is a chemical compound that has gained attention due to its potential applications in medicinal chemistry and materials science. The discovery of this compound is rooted in the exploration of benzothiazole derivatives, a class of heterocyclic compounds known for their wide range of biological activities, including antimicrobial, anticancer, and anti-inflammatory properties.

The synthesis of 5,6-Dimethoxybenzo[d]thiazole typically involves the reaction of a suitable benzothiazole precursor with methoxy groups. These methoxy groups, positioned at the 5th and 6th carbon atoms of the benzothiazole ring, are key to the compound's unique properties. The presence of these groups not only influences the chemical reactivity of the molecule but also enhances its biological activity, making it a valuable candidate for drug development.

One of the primary areas of research involving 5,6-Dimethoxybenzo[d]thiazole is its potential use in cancer treatment. Studies have shown that this compound exhibits cytotoxic effects against certain cancer cell lines, meaning it can selectively kill cancer cells while minimizing damage to normal cells. This selectivity is crucial for developing effective cancer therapies with fewer side effects. The compound's mechanism of action is believed to involve the disruption of specific cellular pathways that are essential for cancer cell survival and proliferation.

In addition to its anticancer potential, 5,6-Dimethoxybenzo[d]thiazole has also been investigated for its antimicrobial properties. It has demonstrated activity against a variety of bacterial strains, including some that are resistant to conventional antibiotics. This makes it a promising candidate for the development of new antimicrobial agents, which are urgently needed in the face of increasing antibiotic resistance.

Beyond its biological applications, 5,6-Dimethoxybenzo[d]thiazole has also been explored for its potential use in materials science. Its unique electronic properties make it a candidate for the development of organic semiconductors, which are used in electronic devices such as organic light-emitting diodes (OLEDs) and organic photovoltaics (OPVs). These materials are attractive for use in flexible and lightweight electronic devices, which are becoming increasingly important in modern technology.

In summary, 5,6-Dimethoxybenzo[d]thiazole is a compound with a wide range of potential applications, from cancer treatment and antimicrobial therapy to materials science. Its unique chemical structure, characterized by the presence of methoxy groups on the benzothiazole ring, plays a crucial role in its biological and electronic properties. As research into this compound continues, it holds promise for contributing to advances in both medicine and technology.
Market Analysis Reports
Related Products
2,6-Dimethoxy-1...  6,15-Dimethoxyb...  4,7-Dimethoxy-2...  4,5-Dimethoxy-1...  5,6-Dimethoxybe...  4,6-Dimethoxy-1...  4,7-Dimethoxy-1...  2,6-Dimethoxy-1...  4,7-Dimethoxy-1...  2,6-Dimethoxy-1...  2,5-Dimethoxy-1...  5,6-Dimethoxy-1...  4,7-Dimethoxy-1...  4,6-Dimethoxy-1...  5,6-Dimethoxy-1...  5,6-Dimethoxy-1...  4-(5,6-Dimethox...  6,7-Dimethoxy-2...  3,4-Dimethoxybe...  2,4-Dimethoxybe...