| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 2-Methyl-2-Propenoic Acid Polymer With Ethenylbenzene And Oxiranylmethyl 2-Methyl-2-Propenoate |
|---|---|
| Synonyms | 2-Methylprop-2-Enoic Acid; 2-Methylprop-2-Enoic Acid 2-Oxiranylmethyl Ester; Styrene; Methacrylic Acid; 2-Methylacrylic Acid Glycidyl Ester; Styrene |
| Molecular Structure | ![]() |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 |
| CAS Registry Number | 58353-15-4 |
| SMILES | C(OC(=O)C(=C)C)C1OC1.CC(C(=O)O)=C.C2=C(C=CC=C2)C=C |
| InChI | 1S/C8H8.C7H10O3.C4H6O2/c1-2-8-6-4-3-5-7-8;1-5(2)7(8)10-4-6-3-9-6;1-3(2)4(5)6/h2-7H,1H2;6H,1,3-4H2,2H3;1H2,2H3,(H,5,6) |
| InChIKey | NNOXSZKYCWGAOL-UHFFFAOYSA-N |
| Boiling point | 189°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 76.1°C (Cal.) |
| Market Analysis Reports |