| Atomax Chemicals Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Nitroisonicotinohydrazide |
|---|---|
| Synonyms | 2-Nitroisonicotinic acid hydrazide; 2-nitroisonicotinohydrazide; Isoniazid analog |
| Molecular Structure | ![]() |
| Molecular Formula | C6H6N4O3 |
| Molecular Weight | 182.14 |
| CAS Registry Number | 58481-05-3 |
| SMILES | O=[N+]([O-])c1nccc(C(=O)NN)c1 |
| InChI | 1S/C6H6N4O3/c7-9-6(11)4-1-2-8-5(3-4)10(12)13/h1-3H,7H2,(H,9,11) |
| InChIKey | AEVNJSOYFOFWDU-UHFFFAOYSA-N |
| Density | 1.493g/cm3 (Cal.) |
|---|---|
| (1) | Philip Prathipati, Ngai Ling Ma* and Thomas H. Keller. Global Bayesian Models for the Prioritization of Antitubercular Agents, J. Chem. Inf. Model., 2008, 48 (12), pp 2362–2370 |
|---|---|
| Market Analysis Reports |