|
CAS#: 58670-63-6 Product: Dinosterol No suppilers available for the product. |
| Name | Dinosterol |
|---|---|
| Synonyms | (3S,4S,5S,8S,9S,10R,13R,14S,17R)-4,10,13-Trimethyl-17-[(E,1R,4R)-1,3,4,5-Tetramethylhex-2-Enyl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-Tetradecahydro-1H-Cyclopenta[A]Phenanthren-3-Ol; 4Alpha,23,24-Trimethyl-5Alpha-Cholest-22-En-3Beta-Ol; Dinosterol |
| Molecular Structure | ![]() |
| Molecular Formula | C30H52O |
| Molecular Weight | 428.74 |
| CAS Registry Number | 58670-63-6 |
| SMILES | [C@]34([C@@H]2[C@H]([C@@H]1CC[C@@H]([C@]1(CC2)C)[C@@H](/C=C(/[C@@H](C(C)C)C)C)C)CC[C@H]3[C@H](C)[C@H](CC4)O)C |
| InChI | 1S/C30H52O/c1-18(2)21(5)19(3)17-20(4)24-11-12-26-23-9-10-25-22(6)28(31)14-16-30(25,8)27(23)13-15-29(24,26)7/h17-18,20-28,31H,9-16H2,1-8H3/b19-17+/t20-,21-,22+,23+,24-,25+,26+,27+,28+,29-,30+/m1/s1 |
| InChIKey | LPFIPZJIWTZLEY-DAABMGJCSA-N |
| Density | 0.9±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 500.3±19.0°C at 760 mmHg (Cal.) |
| Flash point | 222.3±13.7°C (Cal.) |
| (1) | Volkman John K., Barrett Stephanie M., Dunstan Graeme A., Jeffrey S.W.. Geochemical significance of the occurrence of dinosterol and other 4-methyl sterols in a marine diatom, Organic Geochemistry, 1993 |
|---|---|
| Market Analysis Reports |