| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Livchem Logistics GmbH | Germany | |||
|---|---|---|---|---|
![]() |
+49 (69) 3800-2330 | |||
![]() |
customerservice@livchem.com | |||
| Chemical distributor | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| SelectLab Chemicals GmbH | Germany | |||
|---|---|---|---|---|
![]() |
+49 (2383) 919-350 / 919-351 | |||
![]() |
info@selectlab.de, | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 5-Nitro-1H-1,2,4-Triazol-3-Amine |
|---|---|
| Synonyms | (5-Nitro-2H-1,2,4-Triazol-3-Yl)Amine; Nsc153384 |
| Molecular Structure | ![]() |
| Molecular Formula | C2H3N5O2 |
| Molecular Weight | 129.08 |
| CAS Registry Number | 58794-77-7 |
| SMILES | C1(=N[NH]C(=N1)N)[N+]([O-])=O |
| InChI | 1S/C2H3N5O2/c3-1-4-2(6-5-1)7(8)9/h(H3,3,4,5,6) |
| InChIKey | CEYAABCXMIRIGC-UHFFFAOYSA-N |
| Density | 1.889g/cm3 (Cal.) |
|---|---|
| Boiling point | 529.928°C at 760 mmHg (Cal.) |
| Flash point | 274.291°C (Cal.) |
| (1) | Thomas M. Klapötke, Andreas Nordheider and Jörg Stierstorfer. Synthesis and reactivity of an unexpected highly sensitive 1-carboxymethyl-3-diazonio-5-nitrimino-1,2,4-triazole, New J. Chem., 2012, 36, 1463. |
|---|---|
| Market Analysis Reports |