| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 3,3'-Dimethylazobenzene |
|---|---|
| Synonyms | Ar,Ar'-Azotoluene; 3,3'-Azotoluene; Diazene, Bis(3-Methylphenyl)- (9Ci) |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 |
| CAS Registry Number | 588-04-5 |
| EINECS | 209-609-8 |
| SMILES | C1=C(C=CC=C1N=NC2=CC(=CC=C2)C)C |
| InChI | 1S/C14H14N2/c1-11-5-3-7-13(9-11)15-16-14-8-4-6-12(2)10-14/h3-10H,1-2H3 |
| InChIKey | HPSZIXYLILUGIP-UHFFFAOYSA-N |
| Density | 1.008g/cm3 (Cal.) |
|---|---|
| Boiling point | 352.908°C at 760 mmHg (Cal.) |
| Flash point | 159.458°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Kyung-Eun Lee, Hyeong-Tak Jeon, Sam-Yong Han, Jungyeob Ham, Yong-Joo Kim and Soon W. Lee. Cyclopalladated azido complexes containing C,N-donor (HC∼N = 2-(2′-thienyl)pyridine, azobenzene, 3,3′-dimethyl azobenzene, N,N′-dimethylbenzylamine, 2-phenylpyridine) ligands: reactivity towards organic unsaturated compounds and catalytic properties, Dalton Trans., 2009, 6578. |
|---|---|
| Market Analysis Reports |