| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| SynQuest Labs, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Name | 4-Benzylideneaminophenol |
|---|---|
| Synonyms | 4-(Phenylmethyleneamino)Phenol; 4-(Benzylideneamino)Phenol; 4-(Benzalamino)Phenol |
| Molecular Structure | ![]() |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.24 |
| CAS Registry Number | 588-53-4 |
| EINECS | 209-620-8 |
| SMILES | C1=CC(=CC=C1N=CC2=CC=CC=C2)O |
| InChI | 1S/C13H11NO/c15-13-8-6-12(7-9-13)14-10-11-4-2-1-3-5-11/h1-10,15H |
| InChIKey | BVTLIIQDQAUXOI-UHFFFAOYSA-N |
| Density | 1.056g/cm3 (Cal.) |
|---|---|
| Melting point | 185°C (Expl.) |
| Boiling point | 376.757°C at 760 mmHg (Cal.) |
| Flash point | 238.964°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Tabei K, Saitou E. Infrared absorption bands of benzalanilines observed in the 1200-850 cm-1 region, Bulletin of the Chemical Society of Japan, 1969, 42, 2693-2694 |
|---|---|
| Market Analysis Reports |