| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Crescent Chemical Co. Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 348-0333 | |||
![]() |
crescent@creschem.com | |||
| Chemical distributor | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | |||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Classification | Organic raw materials >> Hydrocarbon compounds and their derivatives >> Hydrocarbon halide |
|---|---|
| Name | 1,1,1,2,2,3,3-Heptachloropropane |
| Synonyms | Asym-Heptachloropropane; 257311_Aldrich; Nsc7298 |
| Molecular Structure | ![]() |
| Molecular Formula | C3HCl7 |
| Molecular Weight | 285.21 |
| CAS Registry Number | 594-89-8 |
| EINECS | 209-856-1 |
| SMILES | C(C(C(Cl)(Cl)Cl)(Cl)Cl)(Cl)Cl |
| InChI | 1S/C3HCl7/c4-1(5)2(6,7)3(8,9)10/h1H |
| InChIKey | YFIIENAGGCUHIQ-UHFFFAOYSA-N |
| Density | 1.803g/cm3 (Cal.) |
|---|---|
| Boiling point | 247.931°C at 760 mmHg (Cal.) |
| Flash point | 29°C (Expl.) |
| 102.877°C (Cal.) | |
| SDS | Available |
|---|---|
| Market Analysis Reports |