| APIChem Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (571) 8678-2096 | |||
![]() |
sales@apichemistry.com | |||
| Chemical manufacturer since 2009 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| ChemPacific Corp | USA | |||
|---|---|---|---|---|
![]() |
+1 (410) 633-5771 | |||
![]() |
sales@chempacific.com | |||
| Chemical manufacturer since 1995 | ||||
| Sinova Corporation | USA | |||
|---|---|---|---|---|
![]() |
+1 (301) 961-1525 | |||
![]() |
sales@sinovainc.com | |||
| Chemical manufacturer | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | Evodiamine |
|---|---|
| Synonyms | (+)-Evodiamine; Indol(2',3':3,4)Pyrido(2,1-B)Quinazolin-5(7H)-One, 8,13,13B,14-Tetrahydro-14-Methyl-, (13Bs)-; Indol(2',3':3,4)Pyrido(2,1-B)Quinazolin-5(7H)-One, 8,13,13B,14-Tetrahydro-14-Methyl-, (S)- |
| Molecular Structure | ![]() |
| Molecular Formula | C19H17N3O |
| Molecular Weight | 303.36 |
| CAS Registry Number | 5956-87-6 |
| SMILES | C5=C4N(C3C1=C(C2=C([NH]1)C=CC=C2)CCN3C(C4=CC=C5)=O)C |
| InChI | 1S/C19H17N3O/c1-21-16-9-5-3-7-14(16)19(23)22-11-10-13-12-6-2-4-8-15(12)20-17(13)18(21)22/h2-9,18,20H,10-11H2,1H3 |
| InChIKey | TXDUTHBFYKGSAH-UHFFFAOYSA-N |
| Density | 1.395g/cm3 (Cal.) |
|---|---|
| Boiling point | 575.07°C at 760 mmHg (Cal.) |
| Flash point | 301.592°C (Cal.) |
| (1) | Larry V. Pearce, Pavel A. Petukhov, Tamas Szabo, Noemi Kedei, Fero Bizik, Alan P. Kozikowski and Peter M. Blumberg. Evodiamine functions as an agonist for the vanilloid receptor TRPV1, Org. Biomol. Chem., 2004, 2, 2281. |
|---|---|
| Market Analysis Reports |