|
CAS#: 5958-44-1 Product: (Diphenylphosphino)Methanol No suppilers available for the product. |
| Name | (Diphenylphosphino)Methanol |
|---|---|
| Synonyms | InChI=1/C |
| Molecular Structure | ![]() |
| Molecular Formula | C13H13OP |
| Molecular Weight | 216.22 |
| CAS Registry Number | 5958-44-1 |
| SMILES | C1=CC=C(C=C1)P(CO)C2=CC=CC=C2 |
| InChI | 1S/C13H13OP/c14-11-15(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,14H,11H2 |
| InChIKey | QPECWWIZMZHSDR-UHFFFAOYSA-N |
| Boiling point | 327.4±25.0°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 151.8±23.2°C (Cal.) |
| (1) | Matthew L. Clarke, David J. Cole-Hamilton, Douglas F. Foster, Alexandra M. Z. Slawin and J. Derek Woollins. Co-ordination chemistry and metal catalysed carbonylation reactions using 8-(diphenylphosphino)methylaminoquinoline: a ligand that displays monodentate, bidentate and tridentate co-ordination modes, Dalton Trans., 2002, 0, 1618. |
|---|---|
| Market Analysis Reports |