| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Salicylic Acid, Compound With 2-Aminoethanol |
|---|---|
| Synonyms | Salicylic Acid, Compound With 2-Aminoethanol (1:1) |
| Molecular Structure | ![]() |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 |
| CAS Registry Number | 59866-70-5 |
| EINECS | 261-963-2 |
| SMILES | C1=C(C(=CC=C1)O)C(O)=O.C(N)CO |
| InChI | 1S/C7H6O3.C2H7NO/c8-6-4-2-1-3-5(6)7(9)10;3-1-2-4/h1-4,8H,(H,9,10);4H,1-3H2 |
| InChIKey | WGPVWXXJNUNBNB-UHFFFAOYSA-N |
| Boiling point | 336.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 144.5°C (Cal.) |
| Market Analysis Reports |