| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | Glutamylselenocystathionine |
|---|---|
| Synonyms | (8S)-2,8-Diamino-4-(2-Amino-3-Hydroxy-3-Oxo-Propyl)Selanyl-5-Oxo-Nonanedioic Acid; (8S)-2,8-Diamino-4-[(2-Amino-3-Hydroxy-3-Oxopropyl)Seleno]-5-Oxononanedioic Acid; (8S)-2,8-Diamino-4-[(2-Amino-3-Hydroxy-3-Keto-Propyl)Seleno]-5-Keto-Azelaic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C12H21N3O7Se |
| Molecular Weight | 398.27 |
| CAS Registry Number | 59935-52-3 |
| SMILES | [C@H](C(=O)O)(N)CCC(C(CC(C(=O)O)N)[Se]CC(C(=O)O)N)=O |
| InChI | 1S/C12H21N3O7Se/c13-5(10(17)18)1-2-8(16)9(3-6(14)11(19)20)23-4-7(15)12(21)22/h5-7,9H,1-4,13-15H2,(H,17,18)(H,19,20)(H,21,22)/t5-,6?,7?,9?/m0/s1 |
| InChIKey | POUZOIPGAASHFN-AJTLONOZSA-N |
| Boiling point | 718.052°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 388.064°C (Cal.) |
| (1) | Dernovics Mihaly. Standardless identification of selenocystathionine and its γ-glutamyl derivatives in monkeypot nuts by 3D liquid chromatography with ICP-MS detection followed by nanoHPLC-Q-TOF-MS/MS, The Analyst, 2007 |
|---|---|
| Market Analysis Reports |