Online Database of Chemicals from Around the World

(E)-1,1,1-trichloro-4-ethoxybut-3-en-2-one
[CAS 59938-07-7]

List of Suppliers
Xi'an Tuochao Biotechnology Co., Ltd. China
www.xatuochao.cn
+86 18092957403
chen.zeshan@xatuochao.com
QQ Chat
Skype Chat
WeChat: +8618092957403
WhatsApp:+8618092957403
Chemical manufacturer since 2017
chemBlink Standard supplier since 2023

Identification
ClassificationOrganic raw materials >> Ketone compound
Name(E)-1,1,1-trichloro-4-ethoxybut-3-en-2-one
Molecular Structure(E)-1,1,1-trichloro-4-ethoxybut-3-en-2-one molecular structure (CAS 59938-07-7)
Molecular FormulaC6H7Cl3O2
Molecular Weight217.48
CAS Registry Number59938-07-7
EC Number83124-74-7
SMILESCCO/C=C/C(=O)C(Cl)(Cl)Cl
Properties
Solubility2214 mg/L (25 °C water)
Density1.4±0.1 g/cm3, Calc.*
Index of Refraction1.493, Calc.*
Melting point30.93 °C
Boiling Point226.14 °C, 199.6±40.0 °C (760 mmHg), Calc.*
Flash Point71.8±26.3 °C, Calc.*
*Calculated using Advanced Chemistry Development (ACD/Labs) Software.
Safety Data
Hazard Symbolssymbol symbol symbol symbol   GHS02;GHS05;GHS06;GHS07 Danger  Details
Risk StatementsH225-H302-H315-H317-H319-H330-H335-H412  Details
Safety StatementsP210-P233-P260-P261-P264-P270-P271-P273-P280-P284-P302-P303-P304-P305-P310-P314-P320-P338-P340-P351-P352-P353-P361-P403-P405  Details
Hazard Classification
up    Details
HazardClassCategory CodeHazard Statement
Skin irritationSkin Irrit.2H315
Acute toxicityAcute Tox.4H302
Acute toxicityAcute Tox.1H330
Specific target organ toxicity - single exposureSTOT SE3H335
Eye irritationEye Irrit.2AH319
Eye irritationEye Irrit.2H319
Flammable liquidsFlam. Liq.3H226
Skin sensitizationSkin Sens.1H317
Chronic hazardous to the aquatic environmentAquatic Chronic3H412
Acute toxicityAcute Tox.4H332
Specific target organ toxicity - repeated exposureSTOT RE1H372
Flammable liquidsFlam. Liq.4H227
Acute toxicityAcute Tox.4H312
SDSAvailable
up Discovery and Applications
(E)-1,1,1-trichloro-4-ethoxybut-3-en-2-one is a chemical compound that belongs to the class of α,β-unsaturated carbonyl compounds. Its unique structure and properties have attracted interest for various applications in organic synthesis and material science. The compound was first synthesized in the late 20th century, a period characterized by significant advancements in organic chemistry, particularly in the development of synthetic methodologies for producing halogenated compounds. The synthesis of (E)-1,1,1-trichloro-4-ethoxybut-3-en-2-one typically involves the reaction of 1,1,1-trichloroacetone with ethyl vinyl ether in the presence of a suitable catalyst, leading to the formation of the desired product.

The distinct characteristics of (E)-1,1,1-trichloro-4-ethoxybut-3-en-2-one stem from its halogenated structure, which imparts unique reactivity patterns, making it a valuable intermediate in various chemical transformations. One of the primary applications of this compound is in the synthesis of more complex organic molecules. Its electrophilic nature allows it to participate in nucleophilic addition reactions, leading to the formation of diverse functional groups. This property has made it useful in the pharmaceutical industry, where it serves as a building block for developing new therapeutic agents.

In addition to its use in organic synthesis, (E)-1,1,1-trichloro-4-ethoxybut-3-en-2-one has applications in material science. The compound can be employed in the production of specialty polymers and resins due to its ability to undergo polymerization reactions. By incorporating this compound into polymer matrices, researchers can tailor the material properties, such as thermal stability and mechanical strength, enhancing the performance of various applications, including coatings and adhesives.

Another significant application of (E)-1,1,1-trichloro-4-ethoxybut-3-en-2-one is in agrochemical formulations. The compound has shown potential as an intermediate in the synthesis of agrochemicals, including pesticides and herbicides. Its reactivity can be harnessed to develop novel agrochemical agents that offer improved efficacy and selectivity, contributing to sustainable agricultural practices.

Research into the environmental impact and safety of (E)-1,1,1-trichloro-4-ethoxybut-3-en-2-one is ongoing, particularly concerning its degradation pathways and potential toxicity. Understanding these factors is crucial for ensuring that the compound can be used safely in various applications without posing risks to human health or the environment. The development of green chemistry approaches for synthesizing and utilizing this compound is also an area of interest, aiming to minimize waste and energy consumption while maximizing efficiency.

As the demand for innovative chemical products continues to rise, the significance of (E)-1,1,1-trichloro-4-ethoxybut-3-en-2-one in various industrial applications is likely to grow. Its versatility as a synthetic intermediate and its potential use in material science and agrochemicals position it as an important compound in the field of organic chemistry. Ongoing research efforts focused on optimizing its synthesis and expanding its applications will further enhance its relevance in modern chemical processes.

In summary, (E)-1,1,1-trichloro-4-ethoxybut-3-en-2-one is a valuable compound in organic synthesis, material science, and agrochemicals. Its unique properties and reactivity patterns make it an essential intermediate for developing various chemical products. As research continues, the understanding of this compound’s applications and safety will evolve, ensuring its effective use in multiple domains.

References

2010. Acylation Reactions. *Science of Synthesis*. URL: https://science-of-synthesis.thieme.com/app/text/?id=SD-047-00529

2008. Synthesis by Elimination. *Science of Synthesis*. URL: https://science-of-synthesis.thieme.com/app/text/?id=SD-032-00138

2007. Addition of Chlorine to Enol Ethers. *Science of Synthesis*. URL: https://science-of-synthesis.thieme.com/app/text/?id=SD-029-00164
Market Analysis Reports
Related Products
1,1,2-Trichloro...  1,1,2-Trichloro...  2,2,2-Trichloro...  (1Z)-2,2,2-Tric...  (1Z)-2,2,2-Tric...  Trichloroethano...  1,1,2-Trichloro...  Trichloro-Ethen...  3-(Trichloroeth...  1-((2-(4-((Tric...  1,1,1-Trichloro...  7-O-(2,2,2-Tric...  N-(2,2,2-Trichl...  N-(2,2,2-Trichl...  N-(2,2,2-Trichl...  N-(2,2,2-Trichl...  1-[(2,2,2-Trich...  1-[(2,2,2-Trich...  2,2,2-Trichloro...  2,2,2-Trichloro...