|
CAS#: 60-26-4 Product: Hexamethonium Chloride No suppilers available for the product. |
| Name | Hexamethonium Chloride |
|---|---|
| Synonyms | Trimethyl-(6-Trimethylammoniohexyl)Ammonium Dibromide; D02204; Hexamethonium Bromide (Jan) |
| Molecular Structure | ![]() |
| Molecular Formula | C12H30Br2N2 |
| Molecular Weight | 362.19 |
| CAS Registry Number | 60-26-4 |
| SMILES | C([N+](C)(C)C)CCCCC[N+](C)(C)C.[Br-].[Br-] |
| InChI | 1S/C12H30N2.2BrH/c1-13(2,3)11-9-7-8-10-12-14(4,5)6;;/h7-12H2,1-6H3;2*1H/q+2;;/p-2 |
| InChIKey | FAPSXSAPXXJTOU-UHFFFAOYSA-L |
| solubility | Soluble to 100 mM in water and to 50 mM in DMSO |
|---|---|
| Market Analysis Reports |