| Enamine Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 537-3218 | |||
![]() |
enamine@enamine.net | |||
| Chemical manufacturer since 1991 | ||||
| Otava Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Princeton BioMolecular Research, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (732) 355-9920 | |||
![]() |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Ukrorgsyntez Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+38 (044) 531-9497 | |||
![]() |
sales@uorsy.com | |||
| Chemical manufacturer since 2001 | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | N,N-Diphenylglycine |
|---|---|
| Synonyms | (diphenylamino)acetic acid; (Diphenylamino)aceticacid; 2-(diphenylamino)acetic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 |
| CAS Registry Number | 60085-74-7 |
| SMILES | O=C(O)CN(c1ccccc1)c2ccccc2 |
| InChI | 1S/C14H13NO2/c16-14(17)11-15(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10H,11H2,(H,16,17) |
| InChIKey | KFLKTDAONDZLAN-UHFFFAOYSA-N |
| Density | 1.227g/cm3 (Cal.) |
|---|---|
| Boiling point | 408.093°C at 760 mmHg (Cal.) |
| Flash point | 200.608°C (Cal.) |
| (1) | Lei Liu, Katerina Busuttil, Shuai Zhang, Yanliang Yang, Chen Wang, Flemming Besenbacher and Mingdong Dong. The role of self-assembling polypeptides in building nanomaterials, Phys. Chem. Chem. Phys., 2011, 13, 17435. |
|---|---|
| Market Analysis Reports |