Online Database of Chemicals from Around the World
N-(5,6-diethyl-2,3-dihydro-1H-inden-2-yl)-2,2,2-trifluoroacetamide
[CAS 601487-90-5]
Identification| Name | N-(5,6-diethyl-2,3-dihydro-1H-inden-2-yl)-2,2,2-trifluoroacetamide |
|---|
|
| Molecular Structure |  |
| Molecular Formula | C15H18F3NO |
| Molecular Weight | 285.30 |
| CAS Registry Number | 601487-90-5 |
| SMILES | CCC1=C(C=C2CC(CC2=C1)NC(=O)C(F)(F)F)CC |
|
Properties
| Solubility | 0.8131 mg/L (25 °C water) |
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.502, Calc.* |
| Melting point | 144.11 °C |
| Boiling Point | 380.94 °C, 364.7±42.0 °C (760 mmHg), Calc.* |
| Flash Point | 174.4±27.9 °C, |
|
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
|
Related Products
Diethyl 3,4-dih... Diethyl 2,3-dih... Diethyl 4-(5,6-... Diethyl 3,3'-[(... 1,3-Diethyl-2,3... 2-[(4,4-Diethyl... 5,6-Diethyl-2,3... Diethyl 1,3-dih... (R)-5-[2-[(5,6-... 5-[(1R)-2-[(5,6... 4,4-Diethyl-3,4... Diethyl N-[5-[N... 2,4-Diethyl-1,2... 7,14-Diethyl-7,... 1-[(4S,5R)-4,5-... Diethyl [[[3-(4... 1,3-Diethyldihy... 5,5-Diethyl-2,3... 2,5-Diethyl-3,4... Diethyl 3,6-Dih...