| Carbosynth China Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (512) 6260-5585 | |||
![]() |
sales@carbosynth.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink massive supplier since 2016 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | |||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Vitas-M | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (906) 781-2021 | |||
![]() |
vitas@vitasmlab.com | |||
| Chemical manufacturer since 1998 | ||||
| Zylexa Pharma Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 2-Nitromesitylene |
|---|---|
| Synonyms | 1,3,5-Trimethyl-2-Nitro-Benzene; Ai3-08879; 2,4,6-Trimethyl-1-Nitrobenzene |
| Molecular Structure | ![]() |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 |
| CAS Registry Number | 603-71-4 |
| EINECS | 210-054-9 |
| SMILES | C1=C(C(=C(C=C1C)C)[N+](=O)[O-])C |
| InChI | 1S/C9H11NO2/c1-6-4-7(2)9(10(11)12)8(3)5-6/h4-5H,1-3H3 |
| InChIKey | SCEKDQTVGHRSNS-UHFFFAOYSA-N |
| Density | 1.101g/cm3 (Cal.) |
|---|---|
| Boiling point | 256.913°C at 760 mmHg (Cal.) |
| Flash point | 86.111°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Cyrille Costentin, Marc Robert and Jean-Michel Savéant. Reorganization energies and pre-exponential factors in the one-electron electrochemical and homogeneous oxidation of phenols coupled with an intramolecular amine-driven proton transfer, Phys. Chem. Chem. Phys., 2010, 12, 13061. |
|---|---|
| Market Analysis Reports |